C17H16Cl2FN3O2 — CID 90634216
2,4-dichloro-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]benzamide (PubChem CID 90634216) has the molecular formula C17H16Cl2FN3O2 and a molecular weight of 384.24 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]benzamide |
|---|---|
| PubChem CID | 90634216 |
| Molecular Formula | C17H16Cl2FN3O2 |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 2,4-dichloro-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]benzamide |
| SMILES | O=C(NC1CCC(Oc2ncc(F)cn2)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2FN3O2/c18-10-1-6-14(15(19)7-10)16(24)23-12-2-4-13(5-3-12)25-17-21-8-11(20)9-22-17/h1,6-9,12-13H,2-5H2,(H,23,24) |
| InChIKey | FGRHZQXZTJGMTJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |