C15H15BrFN3O3 — CID 91626383
5-bromo-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]furan-2-carboxamide (PubChem CID 91626383) has the molecular formula C15H15BrFN3O3 and a molecular weight of 384.21 g/mol. Its IUPAC name is 5-bromo-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 91626383 |
| Molecular Formula | C15H15BrFN3O3 |
| Molecular Weight | 384.21 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 5-bromo-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]furan-2-carboxamide |
| SMILES | O=C(NC1CCC(Oc2ncc(F)cn2)CC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H15BrFN3O3/c16-13-6-5-12(23-13)14(21)20-10-1-3-11(4-2-10)22-15-18-7-9(17)8-19-15/h5-8,10-11H,1-4H2,(H,20,21) |
| InChIKey | LDLYCKYNDGEWSI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |