C21H26FN3O3 — CID 90634200
4-butoxy-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]benzamide (PubChem CID 90634200) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is 4-butoxy-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]benzamide.
| Compound Name | 4-butoxy-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]benzamide |
|---|---|
| PubChem CID | 90634200 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 4-butoxy-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC2CCC(Oc3ncc(F)cn3)CC2)cc1 |
| InChI | InChI=1S/C21H26FN3O3/c1-2-3-12-27-18-8-4-15(5-9-18)20(26)25-17-6-10-19(11-7-17)28-21-23-13-16(22)14-24-21/h4-5,8-9,13-14,17,19H,2-3,6-7,10-12H2,1H3,(H,25,26) |
| InChIKey | BZTXTBXTZCTGQF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|