C21H25FN4O4S — CID 90634270
N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 90634270) has the molecular formula C21H25FN4O4S and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 90634270 |
| Molecular Formula | C21H25FN4O4S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NC1CCC(Oc2ncc(F)cn2)CC1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H25FN4O4S/c22-16-13-23-21(24-14-16)30-18-7-5-17(6-8-18)25-20(27)15-3-9-19(10-4-15)31(28,29)26-11-1-2-12-26/h3-4,9-10,13-14,17-18H,1-2,5-8,11-12H2,(H,25,27) |
| InChIKey | OOUMQKJIUJXJEV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |