C22H28N4O4S — CID 90633315
4-piperidin-1-ylsulfonyl-N-(4-pyrimidin-2-yloxycyclohexyl)benzamide (PubChem CID 90633315) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is 4-piperidin-1-ylsulfonyl-N-(4-pyrimidin-2-yloxycyclohexyl)benzamide.
| Compound Name | 4-piperidin-1-ylsulfonyl-N-(4-pyrimidin-2-yloxycyclohexyl)benzamide |
|---|---|
| PubChem CID | 90633315 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 4-piperidin-1-ylsulfonyl-N-(4-pyrimidin-2-yloxycyclohexyl)benzamide |
| SMILES | O=C(NC1CCC(Oc2ncccn2)CC1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H28N4O4S/c27-21(25-18-7-9-19(10-8-18)30-22-23-13-4-14-24-22)17-5-11-20(12-6-17)31(28,29)26-15-2-1-3-16-26/h4-6,11-14,18-19H,1-3,7-10,15-16H2,(H,25,27) |
| InChIKey | POCSFRCHASZZDD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |