C23H30N3O3S+ — CID 7746205
N-(1-benzylpiperidin-1-ium-4-yl)-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 7746205) has the molecular formula C23H30N3O3S+ and a molecular weight of 428.58 g/mol. Its IUPAC name is N-(1-benzylpiperidin-1-ium-4-yl)-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-(1-benzylpiperidin-1-ium-4-yl)-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 7746205 |
| Molecular Formula | C23H30N3O3S+ |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-(1-benzylpiperidin-1-ium-4-yl)-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NC1CC[NH+](Cc2ccccc2)CC1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C23H29N3O3S/c27-23(20-8-10-22(11-9-20)30(28,29)26-14-4-5-15-26)24-21-12-16-25(17-13-21)18-19-6-2-1-3-7-19/h1-3,6-11,21H,4-5,12-18H2,(H,24,27)/p+1 |
| InChIKey | HNHKOPQEENFDJK-UHFFFAOYSA-O |
| XLogP | 1.45 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |