C14H21FN4O2 — CID 90634473
1-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-3-propan-2-ylurea (PubChem CID 90634473) has the molecular formula C14H21FN4O2 and a molecular weight of 296.35 g/mol. Its IUPAC name is 1-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 90634473 |
| Molecular Formula | C14H21FN4O2 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NC1CCC(Oc2ncc(F)cn2)CC1 |
| InChI | InChI=1S/C14H21FN4O2/c1-9(2)18-13(20)19-11-3-5-12(6-4-11)21-14-16-7-10(15)8-17-14/h7-9,11-12H,3-6H2,1-2H3,(H2,18,19,20) |
| InChIKey | OHCVSUHUFPCTSP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |