C14H17FN6O2 — CID 90634332
N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-1-methyltriazole-4-carboxamide (PubChem CID 90634332) has the molecular formula C14H17FN6O2 and a molecular weight of 320.33 g/mol. Its IUPAC name is N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-1-methyltriazole-4-carboxamide.
| Compound Name | N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-1-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 90634332 |
| Molecular Formula | C14H17FN6O2 |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-1-methyltriazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NC2CCC(Oc3ncc(F)cn3)CC2)nn1 |
| InChI | InChI=1S/C14H17FN6O2/c1-21-8-12(19-20-21)13(22)18-10-2-4-11(5-3-10)23-14-16-6-9(15)7-17-14/h6-8,10-11H,2-5H2,1H3,(H,18,22) |
| InChIKey | MPOMMEOIZGKUNV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |