C14H18FN3O4 — CID 90634183
ethyl 2-[[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]amino]-2-oxoacetate (PubChem CID 90634183) has the molecular formula C14H18FN3O4 and a molecular weight of 311.31 g/mol. Its IUPAC name is ethyl 2-[[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 90634183 |
| Molecular Formula | C14H18FN3O4 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | ethyl 2-[[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NC1CCC(Oc2ncc(F)cn2)CC1 |
| InChI | InChI=1S/C14H18FN3O4/c1-2-21-13(20)12(19)18-10-3-5-11(6-4-10)22-14-16-7-9(15)8-17-14/h7-8,10-11H,2-6H2,1H3,(H,18,19) |
| InChIKey | OJQZHCPIOIFJQK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|