C18H19F2N3O3 — CID 90634253
2-(2-fluorophenoxy)-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]acetamide (PubChem CID 90634253) has the molecular formula C18H19F2N3O3 and a molecular weight of 363.36 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 90634253 |
| Molecular Formula | C18H19F2N3O3 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]acetamide |
| SMILES | O=C(COc1ccccc1F)NC1CCC(Oc2ncc(F)cn2)CC1 |
| InChI | InChI=1S/C18H19F2N3O3/c19-12-9-21-18(22-10-12)26-14-7-5-13(6-8-14)23-17(24)11-25-16-4-2-1-3-15(16)20/h1-4,9-10,13-14H,5-8,11H2,(H,23,24) |
| InChIKey | GSBUDADWLPNXRC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |