C14H19ClFN3O2 — CID 90634187
4-chloro-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]butanamide (PubChem CID 90634187) has the molecular formula C14H19ClFN3O2 and a molecular weight of 315.78 g/mol. Its IUPAC name is 4-chloro-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]butanamide.
| Compound Name | 4-chloro-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]butanamide |
|---|---|
| PubChem CID | 90634187 |
| Molecular Formula | C14H19ClFN3O2 |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 4-chloro-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]butanamide |
| SMILES | O=C(CCCCl)NC1CCC(Oc2ncc(F)cn2)CC1 |
| InChI | InChI=1S/C14H19ClFN3O2/c15-7-1-2-13(20)19-11-3-5-12(6-4-11)21-14-17-8-10(16)9-18-14/h8-9,11-12H,1-7H2,(H,19,20) |
| InChIKey | OGHQEIWQDOSPAR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|