C23H24FN3O3 — CID 90634235
2-ethoxy-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]naphthalene-1-carboxamide (PubChem CID 90634235) has the molecular formula C23H24FN3O3 and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-ethoxy-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]naphthalene-1-carboxamide.
| Compound Name | 2-ethoxy-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 90634235 |
| Molecular Formula | C23H24FN3O3 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-ethoxy-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]naphthalene-1-carboxamide |
| SMILES | CCOc1ccc2ccccc2c1C(=O)NC1CCC(Oc2ncc(F)cn2)CC1 |
| InChI | InChI=1S/C23H24FN3O3/c1-2-29-20-12-7-15-5-3-4-6-19(15)21(20)22(28)27-17-8-10-18(11-9-17)30-23-25-13-16(24)14-26-23/h3-7,12-14,17-18H,2,8-11H2,1H3,(H,27,28) |
| InChIKey | UPYGBBKFQXQOSC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |