C18H18F4N4O2 — CID 90634468
1-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 90634468) has the molecular formula C18H18F4N4O2 and a molecular weight of 398.36 g/mol. Its IUPAC name is 1-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90634468 |
| Molecular Formula | C18H18F4N4O2 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)NC1CCC(Oc2ncc(F)cn2)CC1 |
| InChI | InChI=1S/C18H18F4N4O2/c19-11-9-23-17(24-10-11)28-13-7-5-12(6-8-13)25-16(27)26-15-4-2-1-3-14(15)18(20,21)22/h1-4,9-10,12-13H,5-8H2,(H2,25,26,27) |
| InChIKey | BQWJVUZXIICLHL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |