C23H30ClN3O5 — CID 90633694
N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-3,4,5-triethoxybenzamide (PubChem CID 90633694) has the molecular formula C23H30ClN3O5 and a molecular weight of 463.96 g/mol. Its IUPAC name is N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 90633694 |
| Molecular Formula | C23H30ClN3O5 |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NC2CCC(Oc3ncc(Cl)cn3)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H30ClN3O5/c1-4-29-19-11-15(12-20(30-5-2)21(19)31-6-3)22(28)27-17-7-9-18(10-8-17)32-23-25-13-16(24)14-26-23/h11-14,17-18H,4-10H2,1-3H3,(H,27,28) |
| InChIKey | YPJWYQJISLMBDC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |