C18H17F3N4O4S — CID 162363590
N-[(3R,5S)-1-cyano-5-(methylsulfonylmethyl)pyrrolidin-3-yl]-5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-2-carboxamide (PubChem CID 162363590) has the molecular formula C18H17F3N4O4S and a molecular weight of 442.42 g/mol. Its IUPAC name is N-[(3R,5S)-1-cyano-5-(methylsulfonylmethyl)pyrrolidin-3-yl]-5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-2-carboxamide.
| Compound Name | N-[(3R,5S)-1-cyano-5-(methylsulfonylmethyl)pyrrolidin-3-yl]-5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 162363590 |
| Molecular Formula | C18H17F3N4O4S |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-[(3R,5S)-1-cyano-5-(methylsulfonylmethyl)pyrrolidin-3-yl]-5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-2-carboxamide |
| SMILES | CS(=O)(=O)C[C@@H]1C[C@@H](NC(=O)c2ncc(-c3cccc(C(F)(F)F)c3)o2)CN1C#N |
| InChI | InChI=1S/C18H17F3N4O4S/c1-30(27,28)9-14-6-13(8-25(14)10-22)24-16(26)17-23-7-15(29-17)11-3-2-4-12(5-11)18(19,20)21/h2-5,7,13-14H,6,8-9H2,1H3,(H,24,26)/t13-,14+/m1/s1 |
| InChIKey | FFICYXDKTTWXRX-KGLIPLIRSA-N |
| XLogP | 2.06 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|