C17H20N4O2 — CID 10267681
5-(3-aminophenyl)-N-[(3S,5R)-1-azabicyclo[3.2.1]octan-3-yl]-1,3-oxazole-2-carboxamide (PubChem CID 10267681) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 5-(3-aminophenyl)-N-[(3S,5R)-1-azabicyclo[3.2.1]octan-3-yl]-1,3-oxazole-2-carboxamide.
| Compound Name | 5-(3-aminophenyl)-N-[(3S,5R)-1-azabicyclo[3.2.1]octan-3-yl]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 10267681 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5-(3-aminophenyl)-N-[(3S,5R)-1-azabicyclo[3.2.1]octan-3-yl]-1,3-oxazole-2-carboxamide |
| SMILES | Nc1cccc(-c2cnc(C(=O)N[C@H]3C[C@H]4CCN(C4)C3)o2)c1 |
| InChI | InChI=1S/C17H20N4O2/c18-13-3-1-2-12(7-13)15-8-19-17(23-15)16(22)20-14-6-11-4-5-21(9-11)10-14/h1-3,7-8,11,14H,4-6,9-10,18H2,(H,20,22)/t11-,14+/m1/s1 |
| InChIKey | XSMPTIXNIOTRML-RISCZKNCSA-N |
| XLogP | 1.75 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|