C14H14ClN3O2 — CID 168909393
5-(3-chlorophenyl)-N-pyrrolidin-3-yl-1,3-oxazole-2-carboxamide (PubChem CID 168909393) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-pyrrolidin-3-yl-1,3-oxazole-2-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-pyrrolidin-3-yl-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 168909393 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 5-(3-chlorophenyl)-N-pyrrolidin-3-yl-1,3-oxazole-2-carboxamide |
| SMILES | O=C(NC1CCNC1)c1ncc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C14H14ClN3O2/c15-10-3-1-2-9(6-10)12-8-17-14(20-12)13(19)18-11-4-5-16-7-11/h1-3,6,8,11,16H,4-5,7H2,(H,18,19) |
| InChIKey | DSKJUHYJORSXJL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |