C18H15F3N8O3 — CID 168909044
N-[(3R,5S)-1-cyano-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 168909044) has the molecular formula C18H15F3N8O3 and a molecular weight of 448.37 g/mol. Its IUPAC name is N-[(3R,5S)-1-cyano-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-[(3R,5S)-1-cyano-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 168909044 |
| Molecular Formula | C18H15F3N8O3 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-[(3R,5S)-1-cyano-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | N#CN1C[C@H](NC(=O)c2nnc(-c3cccc(OC(F)(F)F)c3)o2)C[C@H]1Cn1ccnn1 |
| InChI | InChI=1S/C18H15F3N8O3/c19-18(20,21)32-14-3-1-2-11(6-14)16-25-26-17(31-16)15(30)24-12-7-13(28(8-12)10-22)9-29-5-4-23-27-29/h1-6,12-13H,7-9H2,(H,24,30)/t12-,13+/m1/s1 |
| InChIKey | VHPHWANIFODREP-OLZOCXBDSA-N |
| XLogP | 1.58 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|