C16H23N5O — CID 175494441
N-[(3R)-1-cyanopyrrolidin-3-yl]-4-[methyl(2-methylpropyl)amino]pyridine-2-carboxamide (PubChem CID 175494441) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[(3R)-1-cyanopyrrolidin-3-yl]-4-[methyl(2-methylpropyl)amino]pyridine-2-carboxamide.
| Compound Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-4-[methyl(2-methylpropyl)amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175494441 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-4-[methyl(2-methylpropyl)amino]pyridine-2-carboxamide |
| SMILES | CC(C)CN(C)c1ccnc(C(=O)N[C@@H]2CCN(C#N)C2)c1 |
| InChI | InChI=1S/C16H23N5O/c1-12(2)9-20(3)14-4-6-18-15(8-14)16(22)19-13-5-7-21(10-13)11-17/h4,6,8,12-13H,5,7,9-10H2,1-3H3,(H,19,22)/t13-/m1/s1 |
| InChIKey | LYFLTABDCKSEFD-CYBMUJFWSA-N |
| XLogP | 1.46 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|