C16H20N4O — CID 122590666
N-[(3R)-1-cyanopyrrolidin-3-yl]-3-phenylpyrrolidine-1-carboxamide (PubChem CID 122590666) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is N-[(3R)-1-cyanopyrrolidin-3-yl]-3-phenylpyrrolidine-1-carboxamide.
| Compound Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-3-phenylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 122590666 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-3-phenylpyrrolidine-1-carboxamide |
| SMILES | N#CN1CC[C@@H](NC(=O)N2CCC(c3ccccc3)C2)C1 |
| InChI | InChI=1S/C16H20N4O/c17-12-19-8-7-15(11-19)18-16(21)20-9-6-14(10-20)13-4-2-1-3-5-13/h1-5,14-15H,6-11H2,(H,18,21)/t14?,15-/m1/s1 |
| InChIKey | RMACRKNETAJHEE-YSSOQSIOSA-N |
| XLogP | 1.74 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|