C14H20N6O — CID 139451895
N-[(3R)-1-cyanopyrrolidin-3-yl]-3-(5-methyl-1H-pyrazol-4-yl)pyrrolidine-1-carboxamide (PubChem CID 139451895) has the molecular formula C14H20N6O and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[(3R)-1-cyanopyrrolidin-3-yl]-3-(5-methyl-1H-pyrazol-4-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-3-(5-methyl-1H-pyrazol-4-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 139451895 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-3-(5-methyl-1H-pyrazol-4-yl)pyrrolidine-1-carboxamide |
| SMILES | Cc1[nH]ncc1C1CCN(C(=O)N[C@@H]2CCN(C#N)C2)C1 |
| InChI | InChI=1S/C14H20N6O/c1-10-13(6-16-18-10)11-2-5-20(7-11)14(21)17-12-3-4-19(8-12)9-15/h6,11-12H,2-5,7-8H2,1H3,(H,16,18)(H,17,21)/t11?,12-/m1/s1 |
| InChIKey | OCXYEFKXUVHKSP-PIJUOVFKSA-N |
| XLogP | 0.77 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|