C13H20N2 — CID 26871970
[2-[(2S)-2-methylpiperidin-1-yl]phenyl]methanamine (PubChem CID 26871970) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is [2-[(2S)-2-methylpiperidin-1-yl]phenyl]methanamine.
| Compound Name | [2-[(2S)-2-methylpiperidin-1-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 26871970 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | [2-[(2S)-2-methylpiperidin-1-yl]phenyl]methanamine |
| SMILES | C[C@H]1CCCCN1c1ccccc1CN |
| InChI | InChI=1S/C13H20N2/c1-11-6-4-5-9-15(11)13-8-3-2-7-12(13)10-14/h2-3,7-8,11H,4-6,9-10,14H2,1H3/t11-/m0/s1 |
| InChIKey | NADCYVQOPOFMSQ-NSHDSACASA-N |
| XLogP | 2.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |