C14H24Cl2N2 — CID 169489236
[2-methyl-4-(2-methylpiperidin-1-yl)phenyl]methanamine;dihydrochloride (PubChem CID 169489236) has the molecular formula C14H24Cl2N2 and a molecular weight of 291.27 g/mol. Its IUPAC name is [2-methyl-4-(2-methylpiperidin-1-yl)phenyl]methanamine;dihydrochloride.
| Compound Name | [2-methyl-4-(2-methylpiperidin-1-yl)phenyl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 169489236 |
| Molecular Formula | C14H24Cl2N2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [2-methyl-4-(2-methylpiperidin-1-yl)phenyl]methanamine;dihydrochloride |
| SMILES | Cc1cc(N2CCCCC2C)ccc1CN.Cl.Cl |
| InChI | InChI=1S/C14H22N2.2ClH/c1-11-9-14(7-6-13(11)10-15)16-8-4-3-5-12(16)2;;/h6-7,9,12H,3-5,8,10,15H2,1-2H3;2*1H |
| InChIKey | QUSOONWHRRSOTK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|