C14H21Cl2F3N2 — CID 169489145
[2-(2-methylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]methanamine;dihydrochloride (PubChem CID 169489145) has the molecular formula C14H21Cl2F3N2 and a molecular weight of 345.24 g/mol. Its IUPAC name is [2-(2-methylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]methanamine;dihydrochloride.
| Compound Name | [2-(2-methylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 169489145 |
| Molecular Formula | C14H21Cl2F3N2 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [2-(2-methylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]methanamine;dihydrochloride |
| SMILES | CC1CCCCN1c1cc(C(F)(F)F)ccc1CN.Cl.Cl |
| InChI | InChI=1S/C14H19F3N2.2ClH/c1-10-4-2-3-7-19(10)13-8-12(14(15,16)17)6-5-11(13)9-18;;/h5-6,8,10H,2-4,7,9,18H2,1H3;2*1H |
| InChIKey | LHZXLHAYCBGIJC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |