C14H21ClN2 — CID 63783024
2-[2-chloro-6-(2-methylpiperidin-1-yl)phenyl]ethanamine (PubChem CID 63783024) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is 2-[2-chloro-6-(2-methylpiperidin-1-yl)phenyl]ethanamine.
| Compound Name | 2-[2-chloro-6-(2-methylpiperidin-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 63783024 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[2-chloro-6-(2-methylpiperidin-1-yl)phenyl]ethanamine |
| SMILES | CC1CCCCN1c1cccc(Cl)c1CCN |
| InChI | InChI=1S/C14H21ClN2/c1-11-5-2-3-10-17(11)14-7-4-6-13(15)12(14)8-9-16/h4,6-7,11H,2-3,5,8-10,16H2,1H3 |
| InChIKey | IRBDMSODNIBFHX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |