C17H27ClN2 — CID 63782919
2-[2-(4-tert-butylpiperidin-1-yl)-6-chlorophenyl]ethanamine (PubChem CID 63782919) has the molecular formula C17H27ClN2 and a molecular weight of 294.87 g/mol. Its IUPAC name is 2-[2-(4-tert-butylpiperidin-1-yl)-6-chlorophenyl]ethanamine.
| Compound Name | 2-[2-(4-tert-butylpiperidin-1-yl)-6-chlorophenyl]ethanamine |
|---|---|
| PubChem CID | 63782919 |
| Molecular Formula | C17H27ClN2 |
| Molecular Weight | 294.87 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-[2-(4-tert-butylpiperidin-1-yl)-6-chlorophenyl]ethanamine |
| SMILES | CC(C)(C)C1CCN(c2cccc(Cl)c2CCN)CC1 |
| InChI | InChI=1S/C17H27ClN2/c1-17(2,3)13-8-11-20(12-9-13)16-6-4-5-15(18)14(16)7-10-19/h4-6,13H,7-12,19H2,1-3H3 |
| InChIKey | QKPPJUHIZDNWLR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.87 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |