C26H26N2O5 — CID 102432947
diethyl (1S,2R,9E,10S,11R)-9-phenacylidene-12,13-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-triene-12,13-dicarboxylate (PubChem CID 102432947) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is diethyl (1S,2R,9E,10S,11R)-9-phenacylidene-12,13-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-triene-12,13-dicarboxylate.
| Compound Name | diethyl (1S,2R,9E,10S,11R)-9-phenacylidene-12,13-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-triene-12,13-dicarboxylate |
|---|---|
| PubChem CID | 102432947 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | diethyl (1S,2R,9E,10S,11R)-9-phenacylidene-12,13-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-triene-12,13-dicarboxylate |
| SMILES | CCOC(=O)N1[C@@H]2C[C@@H]([C@H]3c4ccccc4/C(=C/C(=O)c4ccccc4)[C@H]32)N1C(=O)OCC |
| InChI | InChI=1S/C26H26N2O5/c1-3-32-25(30)27-20-15-21(28(27)26(31)33-4-2)24-19(14-22(29)16-10-6-5-7-11-16)17-12-8-9-13-18(17)23(20)24/h5-14,20-21,23-24H,3-4,15H2,1-2H3/b19-14-/t20-,21+,23+,24-/m0/s1 |
| InChIKey | AUWFTKSHLHQKIT-CKIJQPORSA-N |
| XLogP | 4.65 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|