C21H34N2O7 — CID 90674811
7-[(1S,4S,5S,6R)-2,3-bis(ethoxycarbonyl)-6-prop-2-enoxy-2,3-diazabicyclo[2.2.1]heptan-5-yl]heptanoic acid (PubChem CID 90674811) has the molecular formula C21H34N2O7 and a molecular weight of 426.51 g/mol. Its IUPAC name is 7-[(1S,4S,5S,6R)-2,3-bis(ethoxycarbonyl)-6-prop-2-enoxy-2,3-diazabicyclo[2.2.1]heptan-5-yl]heptanoic acid.
| Compound Name | 7-[(1S,4S,5S,6R)-2,3-bis(ethoxycarbonyl)-6-prop-2-enoxy-2,3-diazabicyclo[2.2.1]heptan-5-yl]heptanoic acid |
|---|---|
| PubChem CID | 90674811 |
| Molecular Formula | C21H34N2O7 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 7-[(1S,4S,5S,6R)-2,3-bis(ethoxycarbonyl)-6-prop-2-enoxy-2,3-diazabicyclo[2.2.1]heptan-5-yl]heptanoic acid |
| SMILES | C=CCO[C@@H]1[C@@H](CCCCCCC(=O)O)[C@@H]2C[C@@H]1N(C(=O)OCC)N2C(=O)OCC |
| InChI | InChI=1S/C21H34N2O7/c1-4-13-30-19-15(11-9-7-8-10-12-18(24)25)16-14-17(19)23(21(27)29-6-3)22(16)20(26)28-5-2/h4,15-17,19H,1,5-14H2,2-3H3,(H,24,25)/t15-,16-,17-,19+/m0/s1 |
| InChIKey | CQHSTCABPZDRSV-LSTDLKDCSA-N |
| XLogP | 3.59 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|