C13H12O4 — CID 102466469
methyl (2R)-4-oxo-2-phenyl-2,3-dihydropyran-5-carboxylate (PubChem CID 102466469) has the molecular formula C13H12O4 and a molecular weight of 232.24 g/mol. Its IUPAC name is methyl (2R)-4-oxo-2-phenyl-2,3-dihydropyran-5-carboxylate.
| Compound Name | methyl (2R)-4-oxo-2-phenyl-2,3-dihydropyran-5-carboxylate |
|---|---|
| PubChem CID | 102466469 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | methyl (2R)-4-oxo-2-phenyl-2,3-dihydropyran-5-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](c2ccccc2)CC1=O |
| InChI | InChI=1S/C13H12O4/c1-16-13(15)10-8-17-12(7-11(10)14)9-5-3-2-4-6-9/h2-6,8,12H,7H2,1H3/t12-/m1/s1 |
| InChIKey | QZHWRUKSTYDCOR-GFCCVEGCSA-N |
| XLogP | 1.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|