C17H14O4 — CID 102466475
methyl (2R)-2-naphthalen-2-yl-4-oxo-2,3-dihydropyran-5-carboxylate (PubChem CID 102466475) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is methyl (2R)-2-naphthalen-2-yl-4-oxo-2,3-dihydropyran-5-carboxylate.
| Compound Name | methyl (2R)-2-naphthalen-2-yl-4-oxo-2,3-dihydropyran-5-carboxylate |
|---|---|
| PubChem CID | 102466475 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | methyl (2R)-2-naphthalen-2-yl-4-oxo-2,3-dihydropyran-5-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](c2ccc3ccccc3c2)CC1=O |
| InChI | InChI=1S/C17H14O4/c1-20-17(19)14-10-21-16(9-15(14)18)13-7-6-11-4-2-3-5-12(11)8-13/h2-8,10,16H,9H2,1H3/t16-/m1/s1 |
| InChIKey | NIHSPIJKOZDWLU-MRXNPFEDSA-N |
| XLogP | 2.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|