About oxetan-2-yl N-methylcarbamate
oxetan-2-yl N-methylcarbamate (PubChem CID 20764471) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is oxetan-2-yl N-methylcarbamate.
Molecular Properties
| Compound Name | oxetan-2-yl N-methylcarbamate |
| PubChem CID | 20764471 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | oxetan-2-yl N-methylcarbamate |
| SMILES | CNC(=O)OC1CCO1 |
| InChI | InChI=1S/C5H9NO3/c1-6-5(7)9-4-2-3-8-4/h4H,2-3H2,1H3,(H,6,7) |
| InChIKey | ZWBOQGWIIMNKKC-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxetan-2-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetan-2-yl N-methylcarbamate?
The IUPAC name of oxetan-2-yl N-methylcarbamate (CID 20764471) is oxetan-2-yl N-methylcarbamate.
What is the SMILES notation for oxetan-2-yl N-methylcarbamate?
The canonical SMILES for oxetan-2-yl N-methylcarbamate is CNC(=O)OC1CCO1.
What is the InChIKey of oxetan-2-yl N-methylcarbamate?
The InChIKey is ZWBOQGWIIMNKKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-6-5(7)9-4-2-3-8-4/h4H,2-3H2,1H3,(H,6,7).
What are the key properties of oxetan-2-yl N-methylcarbamate?
oxetan-2-yl N-methylcarbamate has a molecular weight of 131.13 g/mol, XLogP of 0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxetan-2-yl N-methylcarbamate is sourced from PubChem (CID 20764471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).