About oxetan-2-yl cyclohexanecarboxylate
oxetan-2-yl cyclohexanecarboxylate (PubChem CID 91463497) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is oxetan-2-yl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | oxetan-2-yl cyclohexanecarboxylate |
| PubChem CID | 91463497 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | oxetan-2-yl cyclohexanecarboxylate |
| SMILES | O=C(OC1CCO1)C1CCCCC1 |
| InChI | InChI=1S/C10H16O3/c11-10(13-9-6-7-12-9)8-4-2-1-3-5-8/h8-9H,1-7H2 |
| InChIKey | IUFAPJWIDDGIGG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxetan-2-yl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetan-2-yl cyclohexanecarboxylate?
The IUPAC name of oxetan-2-yl cyclohexanecarboxylate (CID 91463497) is oxetan-2-yl cyclohexanecarboxylate.
What is the SMILES notation for oxetan-2-yl cyclohexanecarboxylate?
The canonical SMILES for oxetan-2-yl cyclohexanecarboxylate is O=C(OC1CCO1)C1CCCCC1.
What is the InChIKey of oxetan-2-yl cyclohexanecarboxylate?
The InChIKey is IUFAPJWIDDGIGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c11-10(13-9-6-7-12-9)8-4-2-1-3-5-8/h8-9H,1-7H2.
What are the key properties of oxetan-2-yl cyclohexanecarboxylate?
oxetan-2-yl cyclohexanecarboxylate has a molecular weight of 184.23 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxetan-2-yl cyclohexanecarboxylate is sourced from PubChem (CID 91463497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).