oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate

C13H20O5 — CID 140997261

IUPACoxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate
SMILESO=C(OC1CCCCO1)C1CC2CC1C(O)C2O
InChIInChI=1S/C13H20O5/c14-11-7-5-8(12(11)15)9(6-7)13(16)18-10-3-1-2-4-17-10/h7-12,14-15H,1-6H2
InChIKeyJAZWMMLFAQCNGG-UHFFFAOYSA-N
MW256.30 g/mol
LogP0.43
Rot. Bonds2

About oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate

oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 140997261) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate.

Molecular Properties

Compound Nameoxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate
PubChem CID140997261
Molecular FormulaC13H20O5
Molecular Weight256.30 g/mol
Exact Mass256.13
IUPAC Nameoxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate
SMILESO=C(OC1CCCCO1)C1CC2CC1C(O)C2O
InChIInChI=1S/C13H20O5/c14-11-7-5-8(12(11)15)9(6-7)13(16)18-10-3-1-2-4-17-10/h7-12,14-15H,1-6H2
InChIKeyJAZWMMLFAQCNGG-UHFFFAOYSA-N
XLogP0.43
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.30
LogP ≤ 50.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate (CID 140997261) is oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate is O=C(OC1CCCCO1)C1CC2CC1C(O)C2O.
What is the InChIKey of oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is JAZWMMLFAQCNGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O5/c14-11-7-5-8(12(11)15)9(6-7)13(16)18-10-3-1-2-4-17-10/h7-12,14-15H,1-6H2.
What are the key properties of oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate?
oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 256.30 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-yl 5,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 140997261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).