C25H36O12 — CID 161071513
2-hydroxyethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;oxolan-2-yl 5-hydroxy-6-(2-oxopropanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 161071513) has the molecular formula C25H36O12 and a molecular weight of 528.55 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;oxolan-2-yl 5-hydroxy-6-(2-oxopropanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;oxolan-2-yl 5-hydroxy-6-(2-oxopropanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 161071513 |
| Molecular Formula | C25H36O12 |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;oxolan-2-yl 5-hydroxy-6-(2-oxopropanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OCCO.CC(=O)C(=O)OC1C(O)C2CC(C(=O)OC3CCCO3)C1C2 |
| InChI | InChI=1S/C15H20O7.C6H10O3.C4H6O2/c1-7(16)14(18)22-13-9-5-8(12(13)17)6-10(9)15(19)21-11-3-2-4-20-11;1-5(2)6(8)9-4-3-7;1-3(2)4(5)6/h8-13,17H,2-6H2,1H3;7H,1,3-4H2,2H3;1H2,2H3,(H,5,6) |
| InChIKey | UESMBBXPSSPGCB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 182.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|