C13H11FO — CID 146557825
5-fluoro-6-methyl-3-phenylcyclohexa-2,4-dien-1-one (PubChem CID 146557825) has the molecular formula C13H11FO and a molecular weight of 202.23 g/mol. Its IUPAC name is 5-fluoro-6-methyl-3-phenylcyclohexa-2,4-dien-1-one.
| Compound Name | 5-fluoro-6-methyl-3-phenylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 146557825 |
| Molecular Formula | C13H11FO |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 5-fluoro-6-methyl-3-phenylcyclohexa-2,4-dien-1-one |
| SMILES | CC1C(=O)C=C(c2ccccc2)C=C1F |
| InChI | InChI=1S/C13H11FO/c1-9-12(14)7-11(8-13(9)15)10-5-3-2-4-6-10/h2-9H,1H3 |
| InChIKey | KEFORSBFPZSVPH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |