C23H18NO+ — CID 100998592
1,4,6-triphenyl-1H-pyridin-1-ium-2-one (PubChem CID 100998592) has the molecular formula C23H18NO+ and a molecular weight of 324.40 g/mol. Its IUPAC name is 1,4,6-triphenyl-1H-pyridin-1-ium-2-one.
| Compound Name | 1,4,6-triphenyl-1H-pyridin-1-ium-2-one |
|---|---|
| PubChem CID | 100998592 |
| Molecular Formula | C23H18NO+ |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1,4,6-triphenyl-1H-pyridin-1-ium-2-one |
| SMILES | O=C1C=C(c2ccccc2)C=C(c2ccccc2)[NH+]1c1ccccc1 |
| InChI | InChI=1S/C23H17NO/c25-23-17-20(18-10-4-1-5-11-18)16-22(19-12-6-2-7-13-19)24(23)21-14-8-3-9-15-21/h1-17H/p+1 |
| InChIKey | NZSUHQPVASIROZ-UHFFFAOYSA-O |
| XLogP | 3.87 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |