C11H11N3O — CID 135075271
(1R,5R)-5-azido-2-phenylcyclopent-2-en-1-ol (PubChem CID 135075271) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is (1R,5R)-5-azido-2-phenylcyclopent-2-en-1-ol.
| Compound Name | (1R,5R)-5-azido-2-phenylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 135075271 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (1R,5R)-5-azido-2-phenylcyclopent-2-en-1-ol |
| SMILES | [N-]=[N+]=N[C@@H]1CC=C(c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C11H11N3O/c12-14-13-10-7-6-9(11(10)15)8-4-2-1-3-5-8/h1-6,10-11,15H,7H2/t10-,11-/m1/s1 |
| InChIKey | FKGUOZSZKDHYDI-GHMZBOCLSA-N |
| XLogP | 2.51 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|