C17H17N3O — CID 102523610
(1R,2R)-2-azido-4,7-dimethyl-6-phenyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 102523610) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is (1R,2R)-2-azido-4,7-dimethyl-6-phenyl-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1R,2R)-2-azido-4,7-dimethyl-6-phenyl-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 102523610 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (1R,2R)-2-azido-4,7-dimethyl-6-phenyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | Cc1cc(-c2ccccc2)c(C)c2c1C[C@@H](N=[N+]=[N-])[C@@H]2O |
| InChI | InChI=1S/C17H17N3O/c1-10-8-14(12-6-4-3-5-7-12)11(2)16-13(10)9-15(17(16)21)19-20-18/h3-8,15,17,21H,9H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | QXZLITSZFBJMAW-WBVHZDCISA-N |
| XLogP | 4.24 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|