C16H22N2 — CID 174461689
hydrazine;1,2,3,4-tetramethyl-5-phenylbenzene (PubChem CID 174461689) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is hydrazine;1,2,3,4-tetramethyl-5-phenylbenzene.
| Compound Name | hydrazine;1,2,3,4-tetramethyl-5-phenylbenzene |
|---|---|
| PubChem CID | 174461689 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | hydrazine;1,2,3,4-tetramethyl-5-phenylbenzene |
| SMILES | Cc1cc(-c2ccccc2)c(C)c(C)c1C.NN |
| InChI | InChI=1S/C16H18.H4N2/c1-11-10-16(14(4)13(3)12(11)2)15-8-6-5-7-9-15;1-2/h5-10H,1-4H3;1-2H2 |
| InChIKey | JRECKMBULAEGCH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|