C18H15Cl — CID 102481618
7-chloro-1,2-dimethyl-4-phenylnaphthalene (PubChem CID 102481618) has the molecular formula C18H15Cl and a molecular weight of 266.77 g/mol. Its IUPAC name is 7-chloro-1,2-dimethyl-4-phenylnaphthalene.
| Compound Name | 7-chloro-1,2-dimethyl-4-phenylnaphthalene |
|---|---|
| PubChem CID | 102481618 |
| Molecular Formula | C18H15Cl |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 7-chloro-1,2-dimethyl-4-phenylnaphthalene |
| SMILES | Cc1cc(-c2ccccc2)c2ccc(Cl)cc2c1C |
| InChI | InChI=1S/C18H15Cl/c1-12-10-18(14-6-4-3-5-7-14)16-9-8-15(19)11-17(16)13(12)2/h3-11H,1-2H3 |
| InChIKey | KFLDMCUIUYVTIL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |