C15H17NO2S — CID 175248725
2,3,4-trimethyl-6-phenylbenzenesulfonamide (PubChem CID 175248725) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is 2,3,4-trimethyl-6-phenylbenzenesulfonamide.
| Compound Name | 2,3,4-trimethyl-6-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 175248725 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2,3,4-trimethyl-6-phenylbenzenesulfonamide |
| SMILES | Cc1cc(-c2ccccc2)c(S(N)(=O)=O)c(C)c1C |
| InChI | InChI=1S/C15H17NO2S/c1-10-9-14(13-7-5-4-6-8-13)15(19(16,17)18)12(3)11(10)2/h4-9H,1-3H3,(H2,16,17,18) |
| InChIKey | HSZNKHIYXMABKA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |