C25H23P — CID 88878262
[4-[(4R)-2-bicyclo[2.2.1]hept-5-enyl]phenyl]-diphenylphosphane (PubChem CID 88878262) has the molecular formula C25H23P and a molecular weight of 354.43 g/mol. Its IUPAC name is [4-[(4R)-2-bicyclo[2.2.1]hept-5-enyl]phenyl]-diphenylphosphane.
| Compound Name | [4-[(4R)-2-bicyclo[2.2.1]hept-5-enyl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 88878262 |
| Molecular Formula | C25H23P |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [4-[(4R)-2-bicyclo[2.2.1]hept-5-enyl]phenyl]-diphenylphosphane |
| SMILES | C1=C[C@@H]2CC1C(c1ccc(P(c3ccccc3)c3ccccc3)cc1)C2 |
| InChI | InChI=1S/C25H23P/c1-3-7-22(8-4-1)26(23-9-5-2-6-10-23)24-15-13-20(14-16-24)25-18-19-11-12-21(25)17-19/h1-16,19,21,25H,17-18H2/t19-,21?,25?/m1/s1 |
| InChIKey | BPDRCJSFAABTOH-PEJQNEDZSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|