C17H15NO2 — CID 4165398
2-(2-bicyclo[2.2.1]hept-5-enyl)quinoline-4-carboxylic acid (PubChem CID 4165398) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)quinoline-4-carboxylic acid.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 4165398 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)quinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(C2CC3C=CC2C3)nc2ccccc12 |
| InChI | InChI=1S/C17H15NO2/c19-17(20)14-9-16(13-8-10-5-6-11(13)7-10)18-15-4-2-1-3-12(14)15/h1-6,9-11,13H,7-8H2,(H,19,20) |
| InChIKey | QKDDGOCUYOOPRI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|