C15H14N2O2 — CID 95211368
2-[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 95211368) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 95211368 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc([C@@H]3C[C@H]4C=C[C@@H]3C4)[nH]c2c1 |
| InChI | InChI=1S/C15H14N2O2/c18-15(19)10-3-4-12-13(7-10)17-14(16-12)11-6-8-1-2-9(11)5-8/h1-4,7-9,11H,5-6H2,(H,16,17)(H,18,19)/t8-,9+,11+/m0/s1 |
| InChIKey | GPCHOYPRXHAIBE-IQJOONFLSA-N |
| XLogP | 2.94 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|