C30H27NP2 — CID 102464791
[(1R,2S,4R)-7-diphenylphosphanyl-7-azabicyclo[2.2.1]hept-5-en-2-yl]-diphenylphosphane (PubChem CID 102464791) has the molecular formula C30H27NP2 and a molecular weight of 463.50 g/mol. Its IUPAC name is [(1R,2S,4R)-7-diphenylphosphanyl-7-azabicyclo[2.2.1]hept-5-en-2-yl]-diphenylphosphane.
| Compound Name | [(1R,2S,4R)-7-diphenylphosphanyl-7-azabicyclo[2.2.1]hept-5-en-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 102464791 |
| Molecular Formula | C30H27NP2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | [(1R,2S,4R)-7-diphenylphosphanyl-7-azabicyclo[2.2.1]hept-5-en-2-yl]-diphenylphosphane |
| SMILES | C1=C[C@H]2C[C@H](P(c3ccccc3)c3ccccc3)[C@@H]1N2P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H27NP2/c1-5-13-25(14-6-1)32(26-15-7-2-8-16-26)30-23-24-21-22-29(30)31(24)33(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-22,24,29-30H,23H2/t24-,29+,30-/m0/s1 |
| InChIKey | IASWIWHQPIMCSU-NSQMQTOTSA-N |
| XLogP | 5.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|