C18H22NP — CID 155884941
(1R)-2-diphenylphosphanylcyclohexan-1-amine (PubChem CID 155884941) has the molecular formula C18H22NP and a molecular weight of 283.36 g/mol. Its IUPAC name is (1R)-2-diphenylphosphanylcyclohexan-1-amine.
| Compound Name | (1R)-2-diphenylphosphanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 155884941 |
| Molecular Formula | C18H22NP |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (1R)-2-diphenylphosphanylcyclohexan-1-amine |
| SMILES | N[C@@H]1CCCCC1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22NP/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-6,9-12,17-18H,7-8,13-14,19H2/t17-,18?/m1/s1 |
| InChIKey | ZATLZEHZPXYMFE-QNSVNVJESA-N |
| XLogP | 3.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|