C27H38P2 — CID 58900670
[2-[(2R,5R)-2,5-di(propan-2-yl)phospholan-1-yl]cyclopentyl]-diphenylphosphane (PubChem CID 58900670) has the molecular formula C27H38P2 and a molecular weight of 424.55 g/mol. Its IUPAC name is [2-[(2R,5R)-2,5-di(propan-2-yl)phospholan-1-yl]cyclopentyl]-diphenylphosphane.
| Compound Name | [2-[(2R,5R)-2,5-di(propan-2-yl)phospholan-1-yl]cyclopentyl]-diphenylphosphane |
|---|---|
| PubChem CID | 58900670 |
| Molecular Formula | C27H38P2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [2-[(2R,5R)-2,5-di(propan-2-yl)phospholan-1-yl]cyclopentyl]-diphenylphosphane |
| SMILES | CC(C)[C@H]1CC[C@H](C(C)C)P1C1CCCC1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H38P2/c1-20(2)24-18-19-25(21(3)4)29(24)27-17-11-16-26(27)28(22-12-7-5-8-13-22)23-14-9-6-10-15-23/h5-10,12-15,20-21,24-27H,11,16-19H2,1-4H3/t24-,25-,26?,27?/m1/s1 |
| InChIKey | UXNLKRWOTACVBI-BINWOUKTSA-N |
| XLogP | 7.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|