C25H35FeOP — CID 159987676
1-(2-diphenylphosphanylcyclopentyl)ethanol;iron;methylcyclopentane (PubChem CID 159987676) has the molecular formula C25H35FeOP and a molecular weight of 438.37 g/mol. Its IUPAC name is 1-(2-diphenylphosphanylcyclopentyl)ethanol;iron;methylcyclopentane.
| Compound Name | 1-(2-diphenylphosphanylcyclopentyl)ethanol;iron;methylcyclopentane |
|---|---|
| PubChem CID | 159987676 |
| Molecular Formula | C25H35FeOP |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 1-(2-diphenylphosphanylcyclopentyl)ethanol;iron;methylcyclopentane |
| SMILES | CC(O)C1CCCC1P(c1ccccc1)c1ccccc1.CC1CCCC1.[Fe] |
| InChI | InChI=1S/C19H23OP.C6H12.Fe/c1-15(20)18-13-8-14-19(18)21(16-9-4-2-5-10-16)17-11-6-3-7-12-17;1-6-4-2-3-5-6;/h2-7,9-12,15,18-20H,8,13-14H2,1H3;6H,2-5H2,1H3; |
| InChIKey | OGNUHKVCSWMZLC-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|