C40H42F12P2 — CID 90921653
bis[3,5-bis(trifluoromethyl)phenyl]-[[2-(2-dicyclohexylphosphanylphenyl)cyclopentyl]methyl]phosphane (PubChem CID 90921653) has the molecular formula C40H42F12P2 and a molecular weight of 812.70 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]-[[2-(2-dicyclohexylphosphanylphenyl)cyclopentyl]methyl]phosphane.
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]-[[2-(2-dicyclohexylphosphanylphenyl)cyclopentyl]methyl]phosphane |
|---|---|
| PubChem CID | 90921653 |
| Molecular Formula | C40H42F12P2 |
| Molecular Weight | 812.70 g/mol |
| Exact Mass | 812.26 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]-[[2-(2-dicyclohexylphosphanylphenyl)cyclopentyl]methyl]phosphane |
| SMILES | FC(F)(F)c1cc(P(CC2CCCC2c2ccccc2P(C2CCCCC2)C2CCCCC2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C40H42F12P2/c41-37(42,43)26-18-27(38(44,45)46)21-32(20-26)53(33-22-28(39(47,48)49)19-29(23-33)40(50,51)52)24-25-10-9-16-34(25)35-15-7-8-17-36(35)54(30-11-3-1-4-12-30)31-13-5-2-6-14-31/h7-8,15,17-23,25,30-31,34H,1-6,9-14,16,24H2 |
| InChIKey | IOQCMNNGHHBRRB-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.70 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|