C22H17F6P — CID 151512986
(2,3-dimethylphenyl)-bis[4-(trifluoromethyl)phenyl]phosphane (PubChem CID 151512986) has the molecular formula C22H17F6P and a molecular weight of 426.34 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-bis[4-(trifluoromethyl)phenyl]phosphane.
| Compound Name | (2,3-dimethylphenyl)-bis[4-(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 151512986 |
| Molecular Formula | C22H17F6P |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (2,3-dimethylphenyl)-bis[4-(trifluoromethyl)phenyl]phosphane |
| SMILES | Cc1cccc(P(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C22H17F6P/c1-14-4-3-5-20(15(14)2)29(18-10-6-16(7-11-18)21(23,24)25)19-12-8-17(9-13-19)22(26,27)28/h3-13H,1-2H3 |
| InChIKey | PSWIAUWPIQUJSD-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|